About (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol
(4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol (PubChem CID 134194664) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol.
Molecular Properties
| Compound Name | (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol |
| PubChem CID | 134194664 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol |
| SMILES | C/C=c1/[nH]cc(O)/c1=C/C |
| InChI | InChI=1S/C8H11NO/c1-3-6-7(4-2)9-5-8(6)10/h3-5,9-10H,1-2H3/b6-3+,7-4+ |
| InChIKey | SUASMBBMACVZAC-XOKGJFMYSA-N |
| XLogP | 0.32 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol?
The IUPAC name of (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol (CID 134194664) is (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol.
What is the SMILES notation for (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol?
The canonical SMILES for (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol is C/C=c1/[nH]cc(O)/c1=C/C.
What is the InChIKey of (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol?
The InChIKey is SUASMBBMACVZAC-XOKGJFMYSA-N. The full InChI is InChI=1S/C8H11NO/c1-3-6-7(4-2)9-5-8(6)10/h3-5,9-10H,1-2H3/b6-3+,7-4+.
What are the key properties of (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol?
(4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol has a molecular weight of 137.18 g/mol, XLogP of 0.32, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-4,5-di(ethylidene)-1H-pyrrol-3-ol is sourced from PubChem (CID 134194664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).