About 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate
2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate (PubChem CID 134194767) has the molecular formula C23H26FNO2S
and a molecular weight of 399.53 g/mol. Its IUPAC name is 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate |
| PubChem CID | 134194767 |
| Molecular Formula | C23H26FNO2S |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate |
| SMILES | CCCCC(C)COC(=O)CCSc1ccc(-c2ccc(C#N)cc2)c(F)c1 |
| InChI | InChI=1S/C23H26FNO2S/c1-3-4-5-17(2)16-27-23(26)12-13-28-20-10-11-21(22(24)14-20)19-8-6-18(15-25)7-9-19/h6-11,14,17H,3-5,12-13,16H2,1-2H3 |
| InChIKey | KSGLRGRRMAQGGI-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate?
The IUPAC name of 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate (CID 134194767) is 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate.
What is the SMILES notation for 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate?
The canonical SMILES for 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate is CCCCC(C)COC(=O)CCSc1ccc(-c2ccc(C#N)cc2)c(F)c1.
What is the InChIKey of 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate?
The InChIKey is KSGLRGRRMAQGGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26FNO2S/c1-3-4-5-17(2)16-27-23(26)12-13-28-20-10-11-21(22(24)14-20)19-8-6-18(15-25)7-9-19/h6-11,14,17H,3-5,12-13,16H2,1-2H3.
What are the key properties of 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate?
2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate has a molecular weight of 399.53 g/mol, XLogP of 6.22, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate is sourced from PubChem (CID 134194767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).