C13H9NS — CID 134194928
4-methyl-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1,3,6,8,9,11,13-heptaene (PubChem CID 134194928) has the molecular formula C13H9NS and a molecular weight of 211.29 g/mol. Its IUPAC name is 4-methyl-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1,3,6,8,9,11,13-heptaene.
| Compound Name | 4-methyl-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1,3,6,8,9,11,13-heptaene |
|---|---|
| PubChem CID | 134194928 |
| Molecular Formula | C13H9NS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 4-methyl-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1,3,6,8,9,11,13-heptaene |
| SMILES | Cc1nc2c(s1)=CC=C=c1ccccc1=2 |
| InChI | InChI=1S/C13H9NS/c1-9-14-13-11-7-3-2-5-10(11)6-4-8-12(13)15-9/h2-5,7-8H,1H3 |
| InChIKey | ZYULVOZCIUFILQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |