About N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide
N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide (PubChem CID 134194943) has the molecular formula C13H14ClF3N2O
and a molecular weight of 306.72 g/mol. Its IUPAC name is N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide.
Molecular Properties
| Compound Name | N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide |
| PubChem CID | 134194943 |
| Molecular Formula | C13H14ClF3N2O |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide |
| SMILES | C=C(CC)N(NC)C(=O)c1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C13H14ClF3N2O/c1-4-8(2)19(18-3)12(20)11-9(13(15,16)17)6-5-7-10(11)14/h5-7,18H,2,4H2,1,3H3 |
| InChIKey | PQRNSSMRRBPCAM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide?
The IUPAC name of N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide (CID 134194943) is N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide.
What is the SMILES notation for N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide?
The canonical SMILES for N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide is C=C(CC)N(NC)C(=O)c1c(Cl)cccc1C(F)(F)F.
What is the InChIKey of N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide?
The InChIKey is PQRNSSMRRBPCAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClF3N2O/c1-4-8(2)19(18-3)12(20)11-9(13(15,16)17)6-5-7-10(11)14/h5-7,18H,2,4H2,1,3H3.
What are the key properties of N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide?
N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide has a molecular weight of 306.72 g/mol, XLogP of 3.86, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-1-en-2-yl-2-chloro-N'-methyl-6-(trifluoromethyl)benzohydrazide is sourced from PubChem (CID 134194943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).