C10H4F4O — CID 13419514
3,4,5,6-tetrafluoro-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene (PubChem CID 13419514) has the molecular formula C10H4F4O and a molecular weight of 216.13 g/mol. Its IUPAC name is 3,4,5,6-tetrafluoro-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene.
| Compound Name | 3,4,5,6-tetrafluoro-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
|---|---|
| PubChem CID | 13419514 |
| Molecular Formula | C10H4F4O |
| Molecular Weight | 216.13 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 3,4,5,6-tetrafluoro-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C1C=CC2O1 |
| InChI | InChI=1S/C10H4F4O/c11-7-5-3-1-2-4(15-3)6(5)8(12)10(14)9(7)13/h1-4H |
| InChIKey | AOZVTAXLAUTRKH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.13 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|