C14H27N — CID 134195528
(3S,4S)-1-cyclopentyl-4-methyl-3-propan-2-ylpiperidine (PubChem CID 134195528) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is (3S,4S)-1-cyclopentyl-4-methyl-3-propan-2-ylpiperidine.
| Compound Name | (3S,4S)-1-cyclopentyl-4-methyl-3-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 134195528 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (3S,4S)-1-cyclopentyl-4-methyl-3-propan-2-ylpiperidine |
| SMILES | CC(C)[C@@H]1CN(C2CCCC2)CC[C@@H]1C |
| InChI | InChI=1S/C14H27N/c1-11(2)14-10-15(9-8-12(14)3)13-6-4-5-7-13/h11-14H,4-10H2,1-3H3/t12-,14-/m0/s1 |
| InChIKey | CJZGCLPUPKYVPF-JSGCOSHPSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |