C10H13FO3 — CID 134195798
(3aR,6aR)-6-ethyl-5-fluoro-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one (PubChem CID 134195798) has the molecular formula C10H13FO3 and a molecular weight of 200.21 g/mol. Its IUPAC name is (3aR,6aR)-6-ethyl-5-fluoro-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aR,6aR)-6-ethyl-5-fluoro-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 134195798 |
| Molecular Formula | C10H13FO3 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (3aR,6aR)-6-ethyl-5-fluoro-2,2-dimethyl-3a,6a-dihydrocyclopenta[d][1,3]dioxol-4-one |
| SMILES | CCC1=C(F)C(=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C10H13FO3/c1-4-5-6(11)7(12)9-8(5)13-10(2,3)14-9/h8-9H,4H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | UDKXJWVYDIRMFM-BDAKNGLRSA-N |
| XLogP | 1.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|