C14H17N — CID 134195862
N-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]penta-1,4-dien-3-imine (PubChem CID 134195862) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is N-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]penta-1,4-dien-3-imine.
| Compound Name | N-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]penta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 134195862 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]penta-1,4-dien-3-imine |
| SMILES | C=CC(C=C)=N/C(C=C)=C/C=C(/C)C=C |
| InChI | InChI=1S/C14H17N/c1-6-12(5)10-11-14(9-4)15-13(7-2)8-3/h6-11H,1-4H2,5H3/b12-10-,14-11+ |
| InChIKey | WLDUSECQYZXVDJ-NNIWUBQSSA-N |
| XLogP | 4.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|