About N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide
N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide (PubChem CID 13419598) has the molecular formula C13H14N2O4S2
and a molecular weight of 326.40 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide.
Molecular Properties
| Compound Name | N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide |
| PubChem CID | 13419598 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide |
| SMILES | CN(NS(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H14N2O4S2/c1-15(21(18,19)13-10-6-3-7-11-13)14-20(16,17)12-8-4-2-5-9-12/h2-11,14H,1H3 |
| InChIKey | FHLQQZWGNQOLEM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide?
The IUPAC name of N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide (CID 13419598) is N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide.
What is the SMILES notation for N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide?
The canonical SMILES for N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide is CN(NS(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide?
The InChIKey is FHLQQZWGNQOLEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4S2/c1-15(21(18,19)13-10-6-3-7-11-13)14-20(16,17)12-8-4-2-5-9-12/h2-11,14H,1H3.
What are the key properties of N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide?
N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide has a molecular weight of 326.40 g/mol, XLogP of 1.20, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(benzenesulfonyl)-N'-methylbenzenesulfonohydrazide is sourced from PubChem (CID 13419598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).