About 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one
4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one (PubChem CID 13419739) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one.
Molecular Properties
| Compound Name | 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one |
| PubChem CID | 13419739 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one |
| SMILES | CC(C)(O)C1=CC(=O)OC1(C)C |
| InChI | InChI=1S/C9H14O3/c1-8(2,11)6-5-7(10)12-9(6,3)4/h5,11H,1-4H3 |
| InChIKey | YAXNBSGQYMGDCL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one?
The IUPAC name of 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one (CID 13419739) is 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one.
What is the SMILES notation for 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one?
The canonical SMILES for 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one is CC(C)(O)C1=CC(=O)OC1(C)C.
What is the InChIKey of 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one?
The InChIKey is YAXNBSGQYMGDCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-8(2,11)6-5-7(10)12-9(6,3)4/h5,11H,1-4H3.
What are the key properties of 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one?
4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one has a molecular weight of 170.21 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxypropan-2-yl)-5,5-dimethylfuran-2-one is sourced from PubChem (CID 13419739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).