About 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole
5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole (PubChem CID 134197561) has the molecular formula C11H19IN2S
and a molecular weight of 338.26 g/mol. Its IUPAC name is 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole |
| PubChem CID | 134197561 |
| Molecular Formula | C11H19IN2S |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole |
| SMILES | CC(C)(C)CSc1[nH]ncc1C(C)(C)I |
| InChI | InChI=1S/C11H19IN2S/c1-10(2,3)7-15-9-8(6-13-14-9)11(4,5)12/h6H,7H2,1-5H3,(H,13,14) |
| InChIKey | HFSHJSJEVBHGGY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole?
The IUPAC name of 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole (CID 134197561) is 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole.
What is the SMILES notation for 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole?
The canonical SMILES for 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole is CC(C)(C)CSc1[nH]ncc1C(C)(C)I.
What is the InChIKey of 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole?
The InChIKey is HFSHJSJEVBHGGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19IN2S/c1-10(2,3)7-15-9-8(6-13-14-9)11(4,5)12/h6H,7H2,1-5H3,(H,13,14).
What are the key properties of 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole?
5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole has a molecular weight of 338.26 g/mol, XLogP of 4.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethylpropylsulfanyl)-4-(2-iodopropan-2-yl)-1H-pyrazole is sourced from PubChem (CID 134197561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).