C13H14BrF3N2O — CID 134197663
N-[1-(6-bromo-1,2-benzoxazol-3-yl)-2,2,2-trifluoroethyl]butan-1-amine (PubChem CID 134197663) has the molecular formula C13H14BrF3N2O and a molecular weight of 351.17 g/mol. Its IUPAC name is N-[1-(6-bromo-1,2-benzoxazol-3-yl)-2,2,2-trifluoroethyl]butan-1-amine.
| Compound Name | N-[1-(6-bromo-1,2-benzoxazol-3-yl)-2,2,2-trifluoroethyl]butan-1-amine |
|---|---|
| PubChem CID | 134197663 |
| Molecular Formula | C13H14BrF3N2O |
| Molecular Weight | 351.17 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | N-[1-(6-bromo-1,2-benzoxazol-3-yl)-2,2,2-trifluoroethyl]butan-1-amine |
| SMILES | CCCCNC(c1noc2cc(Br)ccc12)C(F)(F)F |
| InChI | InChI=1S/C13H14BrF3N2O/c1-2-3-6-18-12(13(15,16)17)11-9-5-4-8(14)7-10(9)20-19-11/h4-5,7,12,18H,2-3,6H2,1H3 |
| InChIKey | XDJKKFXOENZVJK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.17 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|