C20H24F4O3 — CID 134197739
3-butyl-8-fluoro-7-(7,7,7-trifluoroheptoxy)isochromen-1-one (PubChem CID 134197739) has the molecular formula C20H24F4O3 and a molecular weight of 388.40 g/mol. Its IUPAC name is 3-butyl-8-fluoro-7-(7,7,7-trifluoroheptoxy)isochromen-1-one.
| Compound Name | 3-butyl-8-fluoro-7-(7,7,7-trifluoroheptoxy)isochromen-1-one |
|---|---|
| PubChem CID | 134197739 |
| Molecular Formula | C20H24F4O3 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 3-butyl-8-fluoro-7-(7,7,7-trifluoroheptoxy)isochromen-1-one |
| SMILES | CCCCc1cc2ccc(OCCCCCCC(F)(F)F)c(F)c2c(=O)o1 |
| InChI | InChI=1S/C20H24F4O3/c1-2-3-8-15-13-14-9-10-16(18(21)17(14)19(25)27-15)26-12-7-5-4-6-11-20(22,23)24/h9-10,13H,2-8,11-12H2,1H3 |
| InChIKey | BVDQWMOCZMWMMR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|