C18H9F11N6O — CID 134197870
4-(2,2,3,3,3-pentafluoropropoxy)-N-[2-(trifluoromethyl)-4-pyridinyl]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazin-2-amine (PubChem CID 134197870) has the molecular formula C18H9F11N6O and a molecular weight of 534.29 g/mol. Its IUPAC name is 4-(2,2,3,3,3-pentafluoropropoxy)-N-[2-(trifluoromethyl)-4-pyridinyl]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,2,3,3,3-pentafluoropropoxy)-N-[2-(trifluoromethyl)-4-pyridinyl]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 134197870 |
| Molecular Formula | C18H9F11N6O |
| Molecular Weight | 534.29 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | 4-(2,2,3,3,3-pentafluoropropoxy)-N-[2-(trifluoromethyl)-4-pyridinyl]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)c1cc(Nc2nc(OCC(F)(F)C(F)(F)F)nc(-c3cccc(C(F)(F)F)n3)n2)ccn1 |
| InChI | InChI=1S/C18H9F11N6O/c19-15(20,18(27,28)29)7-36-14-34-12(9-2-1-3-10(32-9)16(21,22)23)33-13(35-14)31-8-4-5-30-11(6-8)17(24,25)26/h1-6H,7H2,(H,30,31,33,34,35) |
| InChIKey | AICMZMIPRFLTDN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|