About 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol
1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol (PubChem CID 134198004) has the molecular formula C26H31NO6
and a molecular weight of 453.54 g/mol. Its IUPAC name is 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol.
Molecular Properties
| Compound Name | 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol |
| PubChem CID | 134198004 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol |
| SMILES | COc1ccc(COc2cnc(C(O)COC(C)C)cc2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H31NO6/c1-18(2)31-17-24(28)23-13-25(32-15-19-5-9-21(29-3)10-6-19)26(14-27-23)33-16-20-7-11-22(30-4)12-8-20/h5-14,18,24,28H,15-17H2,1-4H3 |
| InChIKey | ZMRKFUPOUSQFQQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol?
The IUPAC name of 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol (CID 134198004) is 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol.
What is the SMILES notation for 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol?
The canonical SMILES for 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol is COc1ccc(COc2cnc(C(O)COC(C)C)cc2OCc2ccc(OC)cc2)cc1.
What is the InChIKey of 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol?
The InChIKey is ZMRKFUPOUSQFQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31NO6/c1-18(2)31-17-24(28)23-13-25(32-15-19-5-9-21(29-3)10-6-19)26(14-27-23)33-16-20-7-11-22(30-4)12-8-20/h5-14,18,24,28H,15-17H2,1-4H3.
What are the key properties of 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol?
1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol has a molecular weight of 453.54 g/mol, XLogP of 4.72, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-propan-2-yloxyethanol is sourced from PubChem (CID 134198004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).