About N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine
N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine (PubChem CID 134198077) has the molecular formula C15H14N6
and a molecular weight of 278.32 g/mol. Its IUPAC name is N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine |
| PubChem CID | 134198077 |
| Molecular Formula | C15H14N6 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine |
| SMILES | Cc1nn(C)c2ccc(Nc3n[nH]c4cccnc34)cc12 |
| InChI | InChI=1S/C15H14N6/c1-9-11-8-10(5-6-13(11)21(2)20-9)17-15-14-12(18-19-15)4-3-7-16-14/h3-8H,1-2H3,(H2,17,18,19) |
| InChIKey | OFWYSAPZZFPRPH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine?
The IUPAC name of N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine (CID 134198077) is N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine.
What is the SMILES notation for N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine?
The canonical SMILES for N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine is Cc1nn(C)c2ccc(Nc3n[nH]c4cccnc34)cc12.
What is the InChIKey of N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine?
The InChIKey is OFWYSAPZZFPRPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N6/c1-9-11-8-10(5-6-13(11)21(2)20-9)17-15-14-12(18-19-15)4-3-7-16-14/h3-8H,1-2H3,(H2,17,18,19).
What are the key properties of N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine?
N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine has a molecular weight of 278.32 g/mol, XLogP of 2.90, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dimethylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine is sourced from PubChem (CID 134198077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).