About N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine
N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine (PubChem CID 134198340) has the molecular formula C19H20N6
and a molecular weight of 332.41 g/mol. Its IUPAC name is N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine |
| PubChem CID | 134198340 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine |
| SMILES | Cc1nn(C2CCCC2)c2ccc(Nc3n[nH]c4cccnc34)cc12 |
| InChI | InChI=1S/C19H20N6/c1-12-15-11-13(21-19-18-16(22-23-19)7-4-10-20-18)8-9-17(15)25(24-12)14-5-2-3-6-14/h4,7-11,14H,2-3,5-6H2,1H3,(H2,21,22,23) |
| InChIKey | POOJYZDZOTYNOJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine?
The IUPAC name of N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine (CID 134198340) is N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine.
What is the SMILES notation for N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine?
The canonical SMILES for N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine is Cc1nn(C2CCCC2)c2ccc(Nc3n[nH]c4cccnc34)cc12.
What is the InChIKey of N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine?
The InChIKey is POOJYZDZOTYNOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N6/c1-12-15-11-13(21-19-18-16(22-23-19)7-4-10-20-18)8-9-17(15)25(24-12)14-5-2-3-6-14/h4,7-11,14H,2-3,5-6H2,1H3,(H2,21,22,23).
What are the key properties of N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine?
N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine has a molecular weight of 332.41 g/mol, XLogP of 4.47, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopentyl-3-methylindazol-5-yl)-1H-pyrazolo[4,3-b]pyridin-3-amine is sourced from PubChem (CID 134198340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).