C26H34F2N4O — CID 134199581
3-fluoro-N-[2-[[6-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]ethyl]propan-1-amine (PubChem CID 134199581) has the molecular formula C26H34F2N4O and a molecular weight of 456.58 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[6-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]ethyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[2-[[6-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 134199581 |
| Molecular Formula | C26H34F2N4O |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 3-fluoro-N-[2-[[6-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3-pyridinyl]oxy]ethyl]propan-1-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(OCCNCCCF)cn2)N1CC(C)(C)F |
| InChI | InChI=1S/C26H34F2N4O/c1-18-15-21-20-7-4-5-8-22(20)31-24(21)25(32(18)17-26(2,3)28)23-10-9-19(16-30-23)33-14-13-29-12-6-11-27/h4-5,7-10,16,18,25,29,31H,6,11-15,17H2,1-3H3/t18-,25-/m1/s1 |
| InChIKey | XOOBPJQJFCYHBS-IQGLISFBSA-N |
| XLogP | 4.97 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|