C20H17BrF4N2 — CID 134199583
(1R,3R)-1-(4-bromo-2,6-difluorophenyl)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 134199583) has the molecular formula C20H17BrF4N2 and a molecular weight of 441.27 g/mol. Its IUPAC name is (1R,3R)-1-(4-bromo-2,6-difluorophenyl)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-(4-bromo-2,6-difluorophenyl)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 134199583 |
| Molecular Formula | C20H17BrF4N2 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | (1R,3R)-1-(4-bromo-2,6-difluorophenyl)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(Br)cc2F)N1CC(F)F |
| InChI | InChI=1S/C20H17BrF4N2/c1-10-6-13-12-4-2-3-5-16(12)26-19(13)20(27(10)9-17(24)25)18-14(22)7-11(21)8-15(18)23/h2-5,7-8,10,17,20,26H,6,9H2,1H3/t10-,20-/m1/s1 |
| InChIKey | HMUMDUHBJIQZAE-CFMSYZGJSA-N |
| XLogP | 5.81 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|