About [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene
[(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene (PubChem CID 134199602) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene.
Molecular Properties
| Compound Name | [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene |
| PubChem CID | 134199602 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene |
| SMILES | C=C(C)/N=N/C(=C\C)C(C)(C)C |
| InChI | InChI=1S/C10H18N2/c1-7-9(10(4,5)6)12-11-8(2)3/h7H,2H2,1,3-6H3/b9-7-,12-11+ |
| InChIKey | MKTADVKOFYDLNB-YKMQHTRUSA-N |
| XLogP | 3.92 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene?
The IUPAC name of [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene (CID 134199602) is [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene.
What is the SMILES notation for [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene?
The canonical SMILES for [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene is C=C(C)/N=N/C(=C\C)C(C)(C)C.
What is the InChIKey of [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene?
The InChIKey is MKTADVKOFYDLNB-YKMQHTRUSA-N. The full InChI is InChI=1S/C10H18N2/c1-7-9(10(4,5)6)12-11-8(2)3/h7H,2H2,1,3-6H3/b9-7-,12-11+.
What are the key properties of [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene?
[(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene has a molecular weight of 166.27 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4,4-dimethylpent-2-en-3-yl]-prop-1-en-2-yldiazene is sourced from PubChem (CID 134199602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).