C25H29F5N4 — CID 134199618
N'-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-N-(3-fluoropropyl)ethane-1,2-diamine (PubChem CID 134199618) has the molecular formula C25H29F5N4 and a molecular weight of 480.53 g/mol. Its IUPAC name is N'-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-N-(3-fluoropropyl)ethane-1,2-diamine.
| Compound Name | N'-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-N-(3-fluoropropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 134199618 |
| Molecular Formula | C25H29F5N4 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N'-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-N-(3-fluoropropyl)ethane-1,2-diamine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(NCCNCCCF)cc2F)N1CC(F)F |
| InChI | InChI=1S/C25H29F5N4/c1-15-11-18-17-5-2-3-6-21(17)33-24(18)25(34(15)14-22(29)30)23-19(27)12-16(13-20(23)28)32-10-9-31-8-4-7-26/h2-3,5-6,12-13,15,22,25,31-33H,4,7-11,14H2,1H3/t15-,25-/m1/s1 |
| InChIKey | ONUAMVHKCBWOCJ-SGANQWHYSA-N |
| XLogP | 5.41 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|