C20H18BrF3N2 — CID 134199620
(1R,3R)-1-(4-bromo-2-fluorophenyl)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 134199620) has the molecular formula C20H18BrF3N2 and a molecular weight of 423.28 g/mol. Its IUPAC name is (1R,3R)-1-(4-bromo-2-fluorophenyl)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-(4-bromo-2-fluorophenyl)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 134199620 |
| Molecular Formula | C20H18BrF3N2 |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | (1R,3R)-1-(4-bromo-2-fluorophenyl)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(Br)cc2F)N1CC(F)F |
| InChI | InChI=1S/C20H18BrF3N2/c1-11-8-15-13-4-2-3-5-17(13)25-19(15)20(26(11)10-18(23)24)14-7-6-12(21)9-16(14)22/h2-7,9,11,18,20,25H,8,10H2,1H3/t11-,20-/m1/s1 |
| InChIKey | PXOPSMPILHIJGO-BIBXISHDSA-N |
| XLogP | 5.67 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|