C26H31F5N4 — CID 134199643
N'-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-N-(3-fluoropropyl)-N'-methylethane-1,2-diamine (PubChem CID 134199643) has the molecular formula C26H31F5N4 and a molecular weight of 494.55 g/mol. Its IUPAC name is N'-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-N-(3-fluoropropyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-N-(3-fluoropropyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 134199643 |
| Molecular Formula | C26H31F5N4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | N'-[4-[(1R,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-N-(3-fluoropropyl)-N'-methylethane-1,2-diamine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(N(C)CCNCCCF)cc2F)N1CC(F)F |
| InChI | InChI=1S/C26H31F5N4/c1-16-12-19-18-6-3-4-7-22(18)33-25(19)26(35(16)15-23(30)31)24-20(28)13-17(14-21(24)29)34(2)11-10-32-9-5-8-27/h3-4,6-7,13-14,16,23,26,32-33H,5,8-12,15H2,1-2H3/t16-,26-/m1/s1 |
| InChIKey | SNHSRMMGGYWRFI-AKJBCIBTSA-N |
| XLogP | 5.43 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|