C25H33F2N5O — CID 134199679
3-fluoro-N-[2-[5-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrazin-2-yl]oxyethyl]propan-1-amine (PubChem CID 134199679) has the molecular formula C25H33F2N5O and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-fluoro-N-[2-[5-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrazin-2-yl]oxyethyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[2-[5-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrazin-2-yl]oxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 134199679 |
| Molecular Formula | C25H33F2N5O |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 3-fluoro-N-[2-[5-[(1S,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrazin-2-yl]oxyethyl]propan-1-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2cnc(OCCNCCCF)cn2)N1CC(C)(C)F |
| InChI | InChI=1S/C25H33F2N5O/c1-17-13-19-18-7-4-5-8-20(18)31-23(19)24(32(17)16-25(2,3)27)21-14-30-22(15-29-21)33-12-11-28-10-6-9-26/h4-5,7-8,14-15,17,24,28,31H,6,9-13,16H2,1-3H3/t17-,24-/m1/s1 |
| InChIKey | UAQSDLXOGGADPH-MZNJEOGPSA-N |
| XLogP | 4.37 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|