C23H28F3N5O — CID 134199706
N-[2-[5-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrazin-2-yl]oxyethyl]-3-fluoropropan-1-amine (PubChem CID 134199706) has the molecular formula C23H28F3N5O and a molecular weight of 447.51 g/mol. Its IUPAC name is N-[2-[5-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrazin-2-yl]oxyethyl]-3-fluoropropan-1-amine.
| Compound Name | N-[2-[5-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrazin-2-yl]oxyethyl]-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 134199706 |
| Molecular Formula | C23H28F3N5O |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | N-[2-[5-[(1S,3R)-2-(2,2-difluoroethyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]pyrazin-2-yl]oxyethyl]-3-fluoropropan-1-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2cnc(OCCNCCCF)cn2)N1CC(F)F |
| InChI | InChI=1S/C23H28F3N5O/c1-15-11-17-16-5-2-3-6-18(16)30-22(17)23(31(15)14-20(25)26)19-12-29-21(13-28-19)32-10-9-27-8-4-7-24/h2-3,5-6,12-13,15,20,23,27,30H,4,7-11,14H2,1H3/t15-,23-/m1/s1 |
| InChIKey | GLAVBHZOPWIOCU-IQMFZBJNSA-N |
| XLogP | 3.89 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|