About 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide
4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide (PubChem CID 134200015) has the molecular formula C10H19F2N3O3
and a molecular weight of 267.28 g/mol. Its IUPAC name is 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide.
Molecular Properties
| Compound Name | 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide |
| PubChem CID | 134200015 |
| Molecular Formula | C10H19F2N3O3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide |
| SMILES | NCC(O)C(F)(F)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C10H19F2N3O3/c11-10(12,8(16)7-13)9(17)14-1-2-15-3-5-18-6-4-15/h8,16H,1-7,13H2,(H,14,17) |
| InChIKey | HILQDZFTWWBREL-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide?
The IUPAC name of 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide (CID 134200015) is 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide.
What is the SMILES notation for 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide?
The canonical SMILES for 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide is NCC(O)C(F)(F)C(=O)NCCN1CCOCC1.
What is the InChIKey of 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide?
The InChIKey is HILQDZFTWWBREL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2N3O3/c11-10(12,8(16)7-13)9(17)14-1-2-15-3-5-18-6-4-15/h8,16H,1-7,13H2,(H,14,17).
What are the key properties of 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide?
4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide has a molecular weight of 267.28 g/mol, XLogP of -1.61, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,2-difluoro-3-hydroxy-N-(2-morpholin-4-ylethyl)butanamide is sourced from PubChem (CID 134200015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).