C32H29Cl3F5N3O5 — CID 134200021
(4S)-4-[[(2S)-2-[[(2S)-3-(3-chlorophenyl)-2-(3,5-dichlorophenoxy)propanoyl]amino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 134200021) has the molecular formula C32H29Cl3F5N3O5 and a molecular weight of 736.95 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-[[(2S)-3-(3-chlorophenyl)-2-(3,5-dichlorophenoxy)propanoyl]amino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | (4S)-4-[[(2S)-2-[[(2S)-3-(3-chlorophenyl)-2-(3,5-dichlorophenoxy)propanoyl]amino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 134200021 |
| Molecular Formula | C32H29Cl3F5N3O5 |
| Molecular Weight | 736.95 g/mol |
| Exact Mass | 735.11 |
| IUPAC Name | (4S)-4-[[(2S)-2-[[(2S)-3-(3-chlorophenyl)-2-(3,5-dichlorophenoxy)propanoyl]amino]-2-phenylacetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1cccc(Cl)c1)Oc1cc(Cl)cc(Cl)c1)c1ccccc1)C(=O)C(F)(F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C32H29Cl3F5N3O5/c1-17(2)25(27(44)32(39,40)30(47)41-16-31(36,37)38)42-29(46)26(19-8-4-3-5-9-19)43-28(45)24(12-18-7-6-10-20(33)11-18)48-23-14-21(34)13-22(35)15-23/h3-11,13-15,17,24-26H,12,16H2,1-2H3,(H,41,47)(H,42,46)(H,43,45)/t24-,25-,26-/m0/s1 |
| InChIKey | MCCRWGAOZGFUCT-GSDHBNRESA-N |
| XLogP | 6.52 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.95 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|