C16H24N2O3 — CID 134200027
(4R,5R)-5-[(3Z,5E)-5-methoxyhepta-1,3,5-trien-2-yl]-4-(pyrrolidin-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 134200027) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (4R,5R)-5-[(3Z,5E)-5-methoxyhepta-1,3,5-trien-2-yl]-4-(pyrrolidin-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-5-[(3Z,5E)-5-methoxyhepta-1,3,5-trien-2-yl]-4-(pyrrolidin-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134200027 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (4R,5R)-5-[(3Z,5E)-5-methoxyhepta-1,3,5-trien-2-yl]-4-(pyrrolidin-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | C=C(/C=C\C(=C/C)OC)[C@H]1OC(=O)N[C@@H]1CN1CCCC1 |
| InChI | InChI=1S/C16H24N2O3/c1-4-13(20-3)8-7-12(2)15-14(17-16(19)21-15)11-18-9-5-6-10-18/h4,7-8,14-15H,2,5-6,9-11H2,1,3H3,(H,17,19)/b8-7-,13-4+/t14-,15-/m1/s1 |
| InChIKey | IIKUBWLMVLKLAC-YBVIFJFPSA-N |
| XLogP | 2.22 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|