C20H18F3NO — CID 134200060
(Z)-1,1,1-trifluoro-4-(3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbut-3-en-2-one (PubChem CID 134200060) has the molecular formula C20H18F3NO and a molecular weight of 345.36 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-(3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbut-3-en-2-one.
| Compound Name | (Z)-1,1,1-trifluoro-4-(3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 134200060 |
| Molecular Formula | C20H18F3NO |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-(3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbut-3-en-2-one |
| SMILES | CC1Cc2ccccc2CN1/C=C(\C(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C20H18F3NO/c1-14-11-16-9-5-6-10-17(16)12-24(14)13-18(19(25)20(21,22)23)15-7-3-2-4-8-15/h2-10,13-14H,11-12H2,1H3/b18-13- |
| InChIKey | OTNFFEYTHUTEKX-AQTBWJFISA-N |
| XLogP | 4.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|