C17H20N6OS — CID 134201418
4-(6-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)morpholine (PubChem CID 134201418) has the molecular formula C17H20N6OS and a molecular weight of 356.46 g/mol. Its IUPAC name is 4-(6-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)morpholine.
| Compound Name | 4-(6-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)morpholine |
|---|---|
| PubChem CID | 134201418 |
| Molecular Formula | C17H20N6OS |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-(6-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)morpholine |
| SMILES | c1nc(N2CCNCC2)c2sc3nc(N4CCOCC4)ccc3c2n1 |
| InChI | InChI=1S/C17H20N6OS/c1-2-13(22-7-9-24-10-8-22)21-17-12(1)14-15(25-17)16(20-11-19-14)23-5-3-18-4-6-23/h1-2,11,18H,3-10H2 |
| InChIKey | SRMHUPGGBTUUTH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |