C14H16O3S — CID 134201548
7-[(1Z,3Z,5Z)-1-hydroxyhepta-1,3,5-trien-2-yl]sulfanylcyclohepta-1,3,6-triene-1,3-diol (PubChem CID 134201548) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is 7-[(1Z,3Z,5Z)-1-hydroxyhepta-1,3,5-trien-2-yl]sulfanylcyclohepta-1,3,6-triene-1,3-diol.
| Compound Name | 7-[(1Z,3Z,5Z)-1-hydroxyhepta-1,3,5-trien-2-yl]sulfanylcyclohepta-1,3,6-triene-1,3-diol |
|---|---|
| PubChem CID | 134201548 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 7-[(1Z,3Z,5Z)-1-hydroxyhepta-1,3,5-trien-2-yl]sulfanylcyclohepta-1,3,6-triene-1,3-diol |
| SMILES | C/C=C\C=C/C(=C/O)SC1=CCC=C(O)C=C1O |
| InChI | InChI=1S/C14H16O3S/c1-2-3-4-7-12(10-15)18-14-8-5-6-11(16)9-13(14)17/h2-4,6-10,15-17H,5H2,1H3/b3-2-,7-4-,12-10- |
| InChIKey | JRPINRQSOKSYMJ-SKJKNTIYSA-N |
| XLogP | 4.42 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|