C21H19N5O2S — CID 134201663
5-benzyl-N-[(4S)-7-methyl-6-oxo-7,9-diazatricyclo[6.4.0.02,4]dodeca-1(8),9,11-trien-5-yl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 134201663) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is 5-benzyl-N-[(4S)-7-methyl-6-oxo-7,9-diazatricyclo[6.4.0.02,4]dodeca-1(8),9,11-trien-5-yl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-benzyl-N-[(4S)-7-methyl-6-oxo-7,9-diazatricyclo[6.4.0.02,4]dodeca-1(8),9,11-trien-5-yl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 134201663 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 5-benzyl-N-[(4S)-7-methyl-6-oxo-7,9-diazatricyclo[6.4.0.02,4]dodeca-1(8),9,11-trien-5-yl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CN1C(=O)C(NC(=O)c2nnc(Cc3ccccc3)s2)[C@H]2CC2c2cccnc21 |
| InChI | InChI=1S/C21H19N5O2S/c1-26-18-13(8-5-9-22-18)14-11-15(14)17(21(26)28)23-19(27)20-25-24-16(29-20)10-12-6-3-2-4-7-12/h2-9,14-15,17H,10-11H2,1H3,(H,23,27)/t14?,15-,17?/m0/s1 |
| InChIKey | ZKRDEOCHJIHZLM-CKDBGZEDSA-N |
| XLogP | 2.40 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |