C20H18N6O2S — CID 134201741
5-benzyl-N-[(4S)-7-methyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 134201741) has the molecular formula C20H18N6O2S and a molecular weight of 406.47 g/mol. Its IUPAC name is 5-benzyl-N-[(4S)-7-methyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-benzyl-N-[(4S)-7-methyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 134201741 |
| Molecular Formula | C20H18N6O2S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 5-benzyl-N-[(4S)-7-methyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CN1C(=O)C(NC(=O)c2nnc(Cc3ccccc3)s2)[C@H]2CC2c2nccnc21 |
| InChI | InChI=1S/C20H18N6O2S/c1-26-17-15(21-7-8-22-17)12-10-13(12)16(20(26)28)23-18(27)19-25-24-14(29-19)9-11-5-3-2-4-6-11/h2-8,12-13,16H,9-10H2,1H3,(H,23,27)/t12?,13-,16?/m0/s1 |
| InChIKey | LIWYSXCBKUCLRH-UYJPIKCFSA-N |
| XLogP | 1.80 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |