C24H33N — CID 134201764
N-methyl-2-[6-[1-[6-(2-methylpent-3-en-2-yl)cyclohexa-1,3-dien-1-yl]ethenyl]cyclohexa-1,5-dien-1-yl]propan-1-imine (PubChem CID 134201764) has the molecular formula C24H33N and a molecular weight of 335.54 g/mol. Its IUPAC name is N-methyl-2-[6-[1-[6-(2-methylpent-3-en-2-yl)cyclohexa-1,3-dien-1-yl]ethenyl]cyclohexa-1,5-dien-1-yl]propan-1-imine.
| Compound Name | N-methyl-2-[6-[1-[6-(2-methylpent-3-en-2-yl)cyclohexa-1,3-dien-1-yl]ethenyl]cyclohexa-1,5-dien-1-yl]propan-1-imine |
|---|---|
| PubChem CID | 134201764 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | N-methyl-2-[6-[1-[6-(2-methylpent-3-en-2-yl)cyclohexa-1,3-dien-1-yl]ethenyl]cyclohexa-1,5-dien-1-yl]propan-1-imine |
| SMILES | C=C(C1=CCCC=C1C(C)/C=N/C)C1=CC=CCC1C(C)(C)C=CC |
| InChI | InChI=1S/C24H33N/c1-7-16-24(4,5)23-15-11-10-14-22(23)19(3)21-13-9-8-12-20(21)18(2)17-25-6/h7,10-14,16-18,23H,3,8-9,15H2,1-2,4-6H3/b16-7?,25-17+ |
| InChIKey | XSFDNPSNPWZRCO-QOJXARQLSA-N |
| XLogP | 6.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|