C17H13ClFN3O — CID 134202315
3-(2-chloro-4-pyridinyl)-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine (PubChem CID 134202315) has the molecular formula C17H13ClFN3O and a molecular weight of 329.76 g/mol. Its IUPAC name is 3-(2-chloro-4-pyridinyl)-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine.
| Compound Name | 3-(2-chloro-4-pyridinyl)-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 134202315 |
| Molecular Formula | C17H13ClFN3O |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3-(2-chloro-4-pyridinyl)-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine |
| SMILES | Fc1ccc(-c2nn3c(c2-c2ccnc(Cl)c2)COCC3)cc1 |
| InChI | InChI=1S/C17H13ClFN3O/c18-15-9-12(5-6-20-15)16-14-10-23-8-7-22(14)21-17(16)11-1-3-13(19)4-2-11/h1-6,9H,7-8,10H2 |
| InChIKey | HRPWZPCHLZWBED-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|