About ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate
ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate (PubChem CID 134202700) has the molecular formula C20H16N6O2
and a molecular weight of 372.39 g/mol. Its IUPAC name is ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate |
| PubChem CID | 134202700 |
| Molecular Formula | C20H16N6O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]nc(-c2cccc(C)n2)c1-c1ccc2ncc(C#N)n2c1 |
| InChI | InChI=1S/C20H16N6O2/c1-3-28-20(27)19-17(18(24-25-19)15-6-4-5-12(2)23-15)13-7-8-16-22-10-14(9-21)26(16)11-13/h4-8,10-11H,3H2,1-2H3,(H,24,25) |
| InChIKey | CZZHIRASMNQMKP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 108.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate?
The IUPAC name of ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate (CID 134202700) is ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate.
What is the SMILES notation for ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate?
The canonical SMILES for ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate is CCOC(=O)c1[nH]nc(-c2cccc(C)n2)c1-c1ccc2ncc(C#N)n2c1.
What is the InChIKey of ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate?
The InChIKey is CZZHIRASMNQMKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N6O2/c1-3-28-20(27)19-17(18(24-25-19)15-6-4-5-12(2)23-15)13-7-8-16-22-10-14(9-21)26(16)11-13/h4-8,10-11H,3H2,1-2H3,(H,24,25).
What are the key properties of ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate?
ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate has a molecular weight of 372.39 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3-cyanoimidazo[1,2-a]pyridin-6-yl)-3-(6-methyl-2-pyridinyl)-1H-pyrazole-5-carboxylate is sourced from PubChem (CID 134202700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).