About N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide
N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide (PubChem CID 134202741) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide.
Molecular Properties
| Compound Name | N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide |
| PubChem CID | 134202741 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide |
| SMILES | C=C(/C=C\N(C)C)N/C(CC)=N/CC |
| InChI | InChI=1S/C11H21N3/c1-6-11(12-7-2)13-10(3)8-9-14(4)5/h8-9H,3,6-7H2,1-2,4-5H3,(H,12,13)/b9-8- |
| InChIKey | HGAUQRDNPBRUFB-HJWRWDBZSA-N |
| XLogP | 1.99 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide?
The IUPAC name of N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide (CID 134202741) is N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide.
What is the SMILES notation for N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide?
The canonical SMILES for N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide is C=C(/C=C\N(C)C)N/C(CC)=N/CC.
What is the InChIKey of N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide?
The InChIKey is HGAUQRDNPBRUFB-HJWRWDBZSA-N. The full InChI is InChI=1S/C11H21N3/c1-6-11(12-7-2)13-10(3)8-9-14(4)5/h8-9H,3,6-7H2,1-2,4-5H3,(H,12,13)/b9-8-.
What are the key properties of N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide?
N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide has a molecular weight of 195.31 g/mol, XLogP of 1.99, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-4-(dimethylamino)buta-1,3-dien-2-yl]-N'-ethylpropanimidamide is sourced from PubChem (CID 134202741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).