C19H13IN4O2 — CID 134202747
13-(2-iodo-4-pyridinyl)-4,4-dimethyl-3-oxa-1,7,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15),11,13-hexaen-2-one (PubChem CID 134202747) has the molecular formula C19H13IN4O2 and a molecular weight of 456.24 g/mol. Its IUPAC name is 13-(2-iodo-4-pyridinyl)-4,4-dimethyl-3-oxa-1,7,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15),11,13-hexaen-2-one.
| Compound Name | 13-(2-iodo-4-pyridinyl)-4,4-dimethyl-3-oxa-1,7,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15),11,13-hexaen-2-one |
|---|---|
| PubChem CID | 134202747 |
| Molecular Formula | C19H13IN4O2 |
| Molecular Weight | 456.24 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | 13-(2-iodo-4-pyridinyl)-4,4-dimethyl-3-oxa-1,7,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10(15),11,13-hexaen-2-one |
| SMILES | CC1(C)OC(=O)n2c3nc(-c4ccnc(I)c4)ccc3c3cncc1c32 |
| InChI | InChI=1S/C19H13IN4O2/c1-19(2)13-9-21-8-12-11-3-4-14(10-5-6-22-15(20)7-10)23-17(11)24(16(12)13)18(25)26-19/h3-9H,1-2H3 |
| InChIKey | WPKIMUSQTWJTEV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|