C18H22ClN3 — CID 134202982
5-[2-chloro-4-[(2-methylpyrrolidin-1-yl)methyl]phenyl]-3-methylpyridin-2-amine (PubChem CID 134202982) has the molecular formula C18H22ClN3 and a molecular weight of 315.85 g/mol. Its IUPAC name is 5-[2-chloro-4-[(2-methylpyrrolidin-1-yl)methyl]phenyl]-3-methylpyridin-2-amine.
| Compound Name | 5-[2-chloro-4-[(2-methylpyrrolidin-1-yl)methyl]phenyl]-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 134202982 |
| Molecular Formula | C18H22ClN3 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 5-[2-chloro-4-[(2-methylpyrrolidin-1-yl)methyl]phenyl]-3-methylpyridin-2-amine |
| SMILES | Cc1cc(-c2ccc(CN3CCCC3C)cc2Cl)cnc1N |
| InChI | InChI=1S/C18H22ClN3/c1-12-8-15(10-21-18(12)20)16-6-5-14(9-17(16)19)11-22-7-3-4-13(22)2/h5-6,8-10,13H,3-4,7,11H2,1-2H3,(H2,20,21) |
| InChIKey | DUSXIJPDYDOCLY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |