About cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate
cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate (PubChem CID 134203900) has the molecular formula C20H22N4O2S
and a molecular weight of 382.49 g/mol. Its IUPAC name is cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate.
Molecular Properties
| Compound Name | cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate |
| PubChem CID | 134203900 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate |
| SMILES | Cc1ncc(-c2ccc3nc(N)sc3c2)cc1NC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C20H22N4O2S/c1-12-17(24-20(25)26-15-5-3-2-4-6-15)9-14(11-22-12)13-7-8-16-18(10-13)27-19(21)23-16/h7-11,15H,2-6H2,1H3,(H2,21,23)(H,24,25) |
| InChIKey | CHIALCCOCRKKTO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate?
The IUPAC name of cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate (CID 134203900) is cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate.
What is the SMILES notation for cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate?
The canonical SMILES for cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate is Cc1ncc(-c2ccc3nc(N)sc3c2)cc1NC(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate?
The InChIKey is CHIALCCOCRKKTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O2S/c1-12-17(24-20(25)26-15-5-3-2-4-6-15)9-14(11-22-12)13-7-8-16-18(10-13)27-19(21)23-16/h7-11,15H,2-6H2,1H3,(H2,21,23)(H,24,25).
What are the key properties of cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate?
cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate has a molecular weight of 382.49 g/mol, XLogP of 5.13, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl N-[5-(2-amino-1,3-benzothiazol-6-yl)-2-methyl-3-pyridinyl]carbamate is sourced from PubChem (CID 134203900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).