About cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate
cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate (PubChem CID 134203942) has the molecular formula C22H24N4O3S
and a molecular weight of 424.53 g/mol. Its IUPAC name is cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate.
Molecular Properties
| Compound Name | cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate |
| PubChem CID | 134203942 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate |
| SMILES | CC(=O)Nc1nc2ccc(-c3cc(NC(=O)OC4CCCCC4)c(C)cn3)cc2s1 |
| InChI | InChI=1S/C22H24N4O3S/c1-13-12-23-19(11-18(13)26-22(28)29-16-6-4-3-5-7-16)15-8-9-17-20(10-15)30-21(25-17)24-14(2)27/h8-12,16H,3-7H2,1-2H3,(H,23,26,28)(H,24,25,27) |
| InChIKey | PZYCFEBBTZIPOB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate?
The IUPAC name of cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate (CID 134203942) is cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate.
What is the SMILES notation for cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate?
The canonical SMILES for cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate is CC(=O)Nc1nc2ccc(-c3cc(NC(=O)OC4CCCCC4)c(C)cn3)cc2s1.
What is the InChIKey of cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate?
The InChIKey is PZYCFEBBTZIPOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O3S/c1-13-12-23-19(11-18(13)26-22(28)29-16-6-4-3-5-7-16)15-8-9-17-20(10-15)30-21(25-17)24-14(2)27/h8-12,16H,3-7H2,1-2H3,(H,23,26,28)(H,24,25,27).
What are the key properties of cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate?
cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate has a molecular weight of 424.53 g/mol, XLogP of 5.51, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl N-[2-(2-acetamido-1,3-benzothiazol-6-yl)-5-methyl-4-pyridinyl]carbamate is sourced from PubChem (CID 134203942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).