C41H77NO — CID 134205151
(11Z,14Z)-2-[(dimethylamino)methyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-ol (PubChem CID 134205151) has the molecular formula C41H77NO and a molecular weight of 600.07 g/mol. Its IUPAC name is (11Z,14Z)-2-[(dimethylamino)methyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-ol.
| Compound Name | (11Z,14Z)-2-[(dimethylamino)methyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-ol |
|---|---|
| PubChem CID | 134205151 |
| Molecular Formula | C41H77NO |
| Molecular Weight | 600.07 g/mol |
| Exact Mass | 599.60 |
| IUPAC Name | (11Z,14Z)-2-[(dimethylamino)methyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CO)(CCCCCCCC/C=C\C/C=C\CCCCC)CN(C)C |
| InChI | InChI=1S/C41H77NO/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41(40-43,39-42(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,43H,5-12,17-18,23-40H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | MCQSBHKPNJFHAY-KWXKLSQISA-N |
| XLogP | 12.93 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.07 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|