C59H109NO — CID 134205191
(6Z,9Z,29Z,32Z)-20-[(dimethylamino)methyl]-20-[(9Z,12Z)-octadeca-9,12-dienyl]octatriaconta-6,9,29,32-tetraen-19-ol (PubChem CID 134205191) has the molecular formula C59H109NO and a molecular weight of 848.53 g/mol. Its IUPAC name is (6Z,9Z,29Z,32Z)-20-[(dimethylamino)methyl]-20-[(9Z,12Z)-octadeca-9,12-dienyl]octatriaconta-6,9,29,32-tetraen-19-ol.
| Compound Name | (6Z,9Z,29Z,32Z)-20-[(dimethylamino)methyl]-20-[(9Z,12Z)-octadeca-9,12-dienyl]octatriaconta-6,9,29,32-tetraen-19-ol |
|---|---|
| PubChem CID | 134205191 |
| Molecular Formula | C59H109NO |
| Molecular Weight | 848.53 g/mol |
| Exact Mass | 847.85 |
| IUPAC Name | (6Z,9Z,29Z,32Z)-20-[(dimethylamino)methyl]-20-[(9Z,12Z)-octadeca-9,12-dienyl]octatriaconta-6,9,29,32-tetraen-19-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(O)C(CCCCCCCC/C=C\C/C=C\CCCCC)(CCCCCCCC/C=C\C/C=C\CCCCC)CN(C)C |
| InChI | InChI=1S/C59H109NO/c1-6-9-12-15-18-21-24-27-30-33-36-39-42-45-48-51-54-58(61)59(57-60(4)5,55-52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-2)56-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-3/h18-23,27-32,58,61H,6-17,24-26,33-57H2,1-5H3/b21-18-,22-19-,23-20-,30-27-,31-28-,32-29- |
| InChIKey | IZXUESJNJSCOCZ-CWJLHRMTSA-N |
| XLogP | 19.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.53 |
| LogP ≤ 5 | 19.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|