C23H24N2O7 — CID 1342053
4,5-dimethoxy-2-[[2-(3-methylbutyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid (PubChem CID 1342053) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[[2-(3-methylbutyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid.
| Compound Name | 4,5-dimethoxy-2-[[2-(3-methylbutyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1342053 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 4,5-dimethoxy-2-[[2-(3-methylbutyl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
| SMILES | COc1cc(NC(=O)c2ccc3c(c2)C(=O)N(CCC(C)C)C3=O)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C23H24N2O7/c1-12(2)7-8-25-21(27)14-6-5-13(9-15(14)22(25)28)20(26)24-17-11-19(32-4)18(31-3)10-16(17)23(29)30/h5-6,9-12H,7-8H2,1-4H3,(H,24,26)(H,29,30) |
| InChIKey | IKNGQRLZJPHVHO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_acid_B(3)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|