About (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane
(5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane (PubChem CID 134205436) has the molecular formula C11H21Cl
and a molecular weight of 188.74 g/mol. Its IUPAC name is (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane.
Molecular Properties
| Compound Name | (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane |
| PubChem CID | 134205436 |
| Molecular Formula | C11H21Cl |
| Molecular Weight | 188.74 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane |
| SMILES | CC(C)C1C(C)C[C@@H](C)CC1Cl |
| InChI | InChI=1S/C11H21Cl/c1-7(2)11-9(4)5-8(3)6-10(11)12/h7-11H,5-6H2,1-4H3/t8-,9?,10?,11?/m1/s1 |
| InChIKey | BOGIRXCXYCUUMZ-XUHYKBHQSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane?
The IUPAC name of (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane (CID 134205436) is (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane.
What is the SMILES notation for (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane?
The canonical SMILES for (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane is CC(C)C1C(C)C[C@@H](C)CC1Cl.
What is the InChIKey of (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane?
The InChIKey is BOGIRXCXYCUUMZ-XUHYKBHQSA-N. The full InChI is InChI=1S/C11H21Cl/c1-7(2)11-9(4)5-8(3)6-10(11)12/h7-11H,5-6H2,1-4H3/t8-,9?,10?,11?/m1/s1.
What are the key properties of (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane?
(5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane has a molecular weight of 188.74 g/mol, XLogP of 3.93, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-1-chloro-3,5-dimethyl-2-propan-2-ylcyclohexane is sourced from PubChem (CID 134205436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).