About 4-azido-5-methyl-3,4-dihydro-1H-isochromene
4-azido-5-methyl-3,4-dihydro-1H-isochromene (PubChem CID 134205926) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-azido-5-methyl-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | 4-azido-5-methyl-3,4-dihydro-1H-isochromene |
| PubChem CID | 134205926 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 4-azido-5-methyl-3,4-dihydro-1H-isochromene |
| SMILES | Cc1cccc2c1C(N=[N+]=[N-])COC2 |
| InChI | InChI=1S/C10H11N3O/c1-7-3-2-4-8-5-14-6-9(10(7)8)12-13-11/h2-4,9H,5-6H2,1H3 |
| InChIKey | WQIRJSDRYZIBLS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-5-methyl-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-5-methyl-3,4-dihydro-1H-isochromene?
The IUPAC name of 4-azido-5-methyl-3,4-dihydro-1H-isochromene (CID 134205926) is 4-azido-5-methyl-3,4-dihydro-1H-isochromene.
What is the SMILES notation for 4-azido-5-methyl-3,4-dihydro-1H-isochromene?
The canonical SMILES for 4-azido-5-methyl-3,4-dihydro-1H-isochromene is Cc1cccc2c1C(N=[N+]=[N-])COC2.
What is the InChIKey of 4-azido-5-methyl-3,4-dihydro-1H-isochromene?
The InChIKey is WQIRJSDRYZIBLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c1-7-3-2-4-8-5-14-6-9(10(7)8)12-13-11/h2-4,9H,5-6H2,1H3.
What are the key properties of 4-azido-5-methyl-3,4-dihydro-1H-isochromene?
4-azido-5-methyl-3,4-dihydro-1H-isochromene has a molecular weight of 189.22 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-5-methyl-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 134205926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).