C14H22OS2 — CID 13420663
2-spiro[1,3-dithiolane-2,6'-2,3,4,7,8,8a-hexahydro-1H-naphthalene]-1'-ylethanol (PubChem CID 13420663) has the molecular formula C14H22OS2 and a molecular weight of 270.46 g/mol. Its IUPAC name is 2-spiro[1,3-dithiolane-2,6'-2,3,4,7,8,8a-hexahydro-1H-naphthalene]-1'-ylethanol.
| Compound Name | 2-spiro[1,3-dithiolane-2,6'-2,3,4,7,8,8a-hexahydro-1H-naphthalene]-1'-ylethanol |
|---|---|
| PubChem CID | 13420663 |
| Molecular Formula | C14H22OS2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-spiro[1,3-dithiolane-2,6'-2,3,4,7,8,8a-hexahydro-1H-naphthalene]-1'-ylethanol |
| SMILES | OCCC1CCCC2=CC3(CCC21)SCCS3 |
| InChI | InChI=1S/C14H22OS2/c15-7-5-11-2-1-3-12-10-14(6-4-13(11)12)16-8-9-17-14/h10-11,13,15H,1-9H2 |
| InChIKey | OFHCQMJHFDUWFK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|