C17H28O3 — CID 13420667
5-(1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl)-1,1-dimethoxypentan-3-one (PubChem CID 13420667) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 5-(1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl)-1,1-dimethoxypentan-3-one.
| Compound Name | 5-(1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl)-1,1-dimethoxypentan-3-one |
|---|---|
| PubChem CID | 13420667 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 5-(1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl)-1,1-dimethoxypentan-3-one |
| SMILES | COC(CC(=O)CCC1CCCC2=CCCCC21)OC |
| InChI | InChI=1S/C17H28O3/c1-19-17(20-2)12-15(18)11-10-14-8-5-7-13-6-3-4-9-16(13)14/h6,14,16-17H,3-5,7-12H2,1-2H3 |
| InChIKey | ASIOTXOIWUUOKZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|