About 5,5-difluoropentane-1-sulfonate;tetraethylazanium
5,5-difluoropentane-1-sulfonate;tetraethylazanium (PubChem CID 134207209) has the molecular formula C13H29F2NO3S
and a molecular weight of 317.44 g/mol. Its IUPAC name is 5,5-difluoropentane-1-sulfonate;tetraethylazanium.
Molecular Properties
| Compound Name | 5,5-difluoropentane-1-sulfonate;tetraethylazanium |
| PubChem CID | 134207209 |
| Molecular Formula | C13H29F2NO3S |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 5,5-difluoropentane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])CCCCC(F)F |
| InChI | InChI=1S/C8H20N.C5H10F2O3S/c1-5-9(6-2,7-3)8-4;6-5(7)3-1-2-4-11(8,9)10/h5-8H2,1-4H3;5H,1-4H2,(H,8,9,10)/q+1;/p-1 |
| InChIKey | CWKTVZCBNSSMAT-UHFFFAOYSA-M |
| XLogP | 2.85 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5,5-difluoropentane-1-sulfonate;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoropentane-1-sulfonate;tetraethylazanium?
The IUPAC name of 5,5-difluoropentane-1-sulfonate;tetraethylazanium (CID 134207209) is 5,5-difluoropentane-1-sulfonate;tetraethylazanium.
What is the SMILES notation for 5,5-difluoropentane-1-sulfonate;tetraethylazanium?
The canonical SMILES for 5,5-difluoropentane-1-sulfonate;tetraethylazanium is CC[N+](CC)(CC)CC.O=S(=O)([O-])CCCCC(F)F.
What is the InChIKey of 5,5-difluoropentane-1-sulfonate;tetraethylazanium?
The InChIKey is CWKTVZCBNSSMAT-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.C5H10F2O3S/c1-5-9(6-2,7-3)8-4;6-5(7)3-1-2-4-11(8,9)10/h5-8H2,1-4H3;5H,1-4H2,(H,8,9,10)/q+1;/p-1.
What are the key properties of 5,5-difluoropentane-1-sulfonate;tetraethylazanium?
5,5-difluoropentane-1-sulfonate;tetraethylazanium has a molecular weight of 317.44 g/mol, XLogP of 2.85, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoropentane-1-sulfonate;tetraethylazanium is sourced from PubChem (CID 134207209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).