C12H22F7NO3S — CID 134207523
1,2,2,3,3,4,4-heptafluorobutane-1-sulfonate;tetraethylazanium (PubChem CID 134207523) has the molecular formula C12H22F7NO3S and a molecular weight of 393.37 g/mol. Its IUPAC name is 1,2,2,3,3,4,4-heptafluorobutane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,2,2,3,3,4,4-heptafluorobutane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 134207523 |
| Molecular Formula | C12H22F7NO3S |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1,2,2,3,3,4,4-heptafluorobutane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H20N.C4H3F7O3S/c1-5-9(6-2,7-3)8-4;5-1(6)3(8,9)4(10,11)2(7)15(12,13)14/h5-8H2,1-4H3;1-2H,(H,12,13,14)/q+1;/p-1 |
| InChIKey | NIBKDVVYRRBUPG-UHFFFAOYSA-M |
| XLogP | 3.25 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|